HC2H3O2(aq) + NaHCO3 (s) --> NaC2H3O2(aq) + CO2(g) + H2O(l)
This equation is balanced.
In other terms:
Vinegar and baking soda reacts to form sodium acetate in solution, carbon dioxide gas, and water. The "fizz" that is seen is the production of carbon dioxide gas.
-----------------------------------------------------------------------------------------------------
CH3COOH(aq)+NaHCO3(s)--------- CH3COONa(aq)+H2O(l)+CO2(g)
Yes - the amount of water there makes no difference - vinegar is already dilute acetic (ethanoic) acid.
yes as the vinegar and baking soda are both diluted in strength
Baking Soda and Vinegar combinedmake a fizzing reaction when the Acetic acid in the vinegar reacts with Sodium Bicarbonate (baking soda).
You can get a chemical reaction by mixing baking powder and vinegar together.
a chemical reaction..
There is no specific thing. The chemical reaction is a result of the alkaline baking soda and the acidic vinegar neutralising each other.
Yes
A chemical reaction.
Chemical reaction
Yes this is a chemical reaction The fizzing is Carbon Dioxide being generated as the baking soda reacts with the vinegar.
its a chemical reaction
Baking soda and vinegar is the standard way of making a papier-mache "volcano" for a child's science project. The reaction between baking soda and vinegar is immediate and can be quite intense. Too much baking soda and too much vinegar can make the "lava" erupt to the ceiling of the classroom!
vinegar and baking soda makes the chemical reaction for swimming raisins