A piece of paper can be folded ten times by simply following the simple procedure in a simple way which is simply given below.

• Steps for folding a paper ten times.

1. First of all take a piece of paper.
2. Now, slowly make a fold in the paper.
3. Press tightly to form a crease.
4. Now, move on for the second fold.
5. Be patient don't be in a hurry!!!!!
6. If you are in a hurry, you may commit a mistake which might make you pay a lot afterwards. So, be very careful.
7. Now, it's good time for the 3rd fold.
8. Ensure that the 3rd fold is done properly.
9. Always make straight lines while folding.
10. Now, move on with your forth fold.
11. Don't think that now you can just skip the remaining procedure as you have understood what to do. Always read the warning section and the guidelines section carefully.
12. Now, it's high time for your 5th fold.
13. After the 5th fold, it's time for the sixth one, so don't waste time and do it sincerely.
14. Now, what are you thinking of????
    
15. Yes, you have got it right. It's the correct time for the 7th fold..
16. Now, be careful as the real tough thing starts now.
17. If you want, take physical and mental rest for 10-15 minutes as one small mistake will make everything go wrong.
18. Don't sleep in between....
19. I hope you would be felling better after the rest.
20. O.K. take a deep breath in and get ready for the eight fold.
21. Don't panic!!
22. Have hope in yourself, it is not at all hard, you can do anything and everything you wish to.
23. Ninth fold is to be done now.
24. Now, it's the last part of it - the tenth fold, just do it-you can do it-it's your aim and goal in life.
25. Congratulations!!!!!!!!! you have done it!!!!!!!! it's party time. Don't forget to invite me.
26. I knew it that you would be surely able to do it.

• Don't take a fresh paper. Take a old and used paper for the activity and try to consume less paper. In this, way you would save paper.
• After the activity, don't burn the paper. The paper can be recycled and reused.
• Don't think that it is easy and don't skip any of the steps.
• Share this with all your near and dear ones.
• Take the guidelines and help of a elder (Your parent, guardian or teacher) inn case of any doubts.
  

OR GO TO http://www.pomonahistorical.org/12times.htm FOR A NOT SWEAT SOLUTION

First, note that sin(a+b)=sin(a)cos(b)+sin(b)cos(a)

[For a proof, see: www.mathsroom.co.uk/downloads/Compound_Angle_Proof.ppt

For the case of b=a, we have:

sin (a+a)=sin(a)cos(a)+sin(a)cos(a)

sin (2a)=2*sin(a)cos(a)

A computer can only distinguish between two states: on and off. So it can only use two numbers.
Because the first computer consisted of rows of switches which were either on - or off. The binary number system uses a 1 and 0 in place of the on and off functions.
Hello,

The computer uses the binary system because the information in a computer is actually electrical pulses (on/off) And because of that we use 0 (off) and 1 (on) to make it easier for us to calculate it :)

Actually, we don't really have a choice in using the binary system. Computers are electrical machines, so we are pretty much forced to use it as the lowest level of communication. Then past that there's hexadecimal, then plain text.
the computer uses binary number system because the computer can understanding the binary language that is (0,1),and data which are entered by the input device the computer can convert each word into binary number that is (0,1)and then it process the data and again convert into machine language(binary language) to high level language and then we can saw and understand the output result.
Binary is used in all computers because at the hardware level everything is simply on or off, 1 or 0. With only two possible symbols to physically represent, binary systems are extremely simple to implement, whether through mechanical means or through electro-chemical means: a switch is either on or off; a capacitor either holds enough electrical charge or it does not; polarised material is either positively charged or it is negatively charged; a punch card either has a hole at a specific location or it does not. Any medium that can easily differentiate between two possible states can therefore be used to store and retrieve digital data. The simpler the data representation is to implement, the faster the machine will operate. And there simply is no numbering system any simpler than binary.
You can represent 0 and 1 with a simple change of state--on or off. And they can be used to convey the most complex data.

Here's an example. Imagine you have a little box with 4 buttons on it. These are the buttons:

1

2

4

8

If you press a button, it equals that number. If you don't press the button, it equals 0. If you press more than one button, they're added together.

Now look what happens if you press the buttons in different combinations:

no presses = 0

press 1 only, total = 1

press 2 only, total = 2

press 1 + 2, total = 3

press 4 only, total = 4

press 1 + 4, total = 5

press 2 + 4, total = 6

press 1 + 2 + 4, total = 7

press 8, total = 8

press 1 + 8, total = 9

And that is exactly how one "byte" (which contains 8 "bits," each of which can just be on or off) expresses the digits from 0 to 9. And so you can make any number, any number at all, because all numbers consist of the digits from 0 to 9. And you can add, subtract, multiply, divide, and more by turning those buttons or switches on and off.

It gets a little more complicated with letters and special characters (all the symbols you can type that aren't letters and numbers), but the principle is the same.

Along with the data, though, you have to make rules for interpreting it. For instance, you have to make a rule that says the first bit is worth 1, the second 2, and so on. And there are very elaborate rules for how the computer receives, translates, and returns all kinds of data. Those rules are definitions and programs. It even has to have rules for making definitions and programs, and those rules add up to what we call a "language."

You see what we can do with computers. If you're old enough to have watched the possibilities grow over the decades, you are probably more amazed than if you have just grown up with it. And we are really only just beginning. What we have now is still very primitive.

Those 0's and 1's (which we call "binary" and which we can use to mean on/off or yes/no) are incredibly powerful when you combine them with logical reasoning.