0
It's sodium lauryl ether sulfate, a class of chemicals having the general formula CH3(CH2)11(OCH2CH2)nSO4Na where nis usually a fairly small number such as 2 or 3. As you can probably guess from the formula, it's a surfactant. It's used in shampoos and other cleansers.
Wiki User
∙ 14y ago
Wiki User
∙ 14y agoa mild surfectant used to clean, its a more gentle form of sodium laureth sulfate, commonly used in shampoo's
Wiki User
∙ 10y agoDisodium lauryl sulfosuccinate is a salt used in beauty products as a foam-boosting cleansing agent. It is a large molecule and can't penetrate the skin.
Add your answer:
Earn +20 pts
What is disodium?
Disodium is a compound that is usually used as a food addictive.
What is sodium lauryl sulfoacetate?
Sodium lauryl sulfoacetate is a component of some cosmetics (as a surfactant agent).
What is the compound for the formula Na2HPO4?
Na2HPO4 is disodium phosphate or disodium hydrogen phosphate.
Does ammonium lauryl sulfate have sulpha drugs in it?
Pure lauryl ammonium sulfate is not and does not contain sulfa drugs.
Why you use Disodium tartrate for kf titration?
why disodium tartrate is used insead of water
Is sulfosuccinate a sulfate?
NO. Sulfates are irritating in part because they're small molecules that can penetrate the skin. Disodium Laureth Sulfosuccinate is a larger molecule that can't penetrate skin. Disodium Laureth Sulfosuccinate is known to be very gentle to the skin, even at very high concentrations it remains non-irritating to even sensitive skin types. Disodium Laureth Sulfosuccinate has not been sulfated in the production process which makes it free of sulfates. Even though it may sound alike, it is not a Laurel Sulfate. all in all, If you own a shampoo that is sulfate free, but contains sulfosuccinate, then you are ok, this is not harming your hair.
Is sulfosuccinate a sulfa?
no
Can sodium succinate used instead of sodium sulfosuccinate?
The answer to this question would seem to depend on the purpose intended for the sodium sulfosuccinate.
Is soduim diocytl sulfosuccinate an aromatic?
Not
What is DOSS?
dioctyl sodium sulfosuccinate
Are lauryl glucoside and sodium lauryl sulfate interchangable?
no
What is the chemical formula for ammonium lauryl?
The chemical formula for ammonium lauryl is C12H29NO4S
What is disodium?
Disodium is a compound that is usually used as a food addictive.
What is disodium guanylate made from?
The chemical formula of disodium guanylate is: C10H12N5Na2O8P.
What is dioctyl sodium sulfosuccinate?
aka docusate sodium, a stool softener.
What is sodium lauryl sulfoacetate?
Sodium lauryl sulfoacetate is a component of some cosmetics (as a surfactant agent).
What is the chemical formula of disodium phosphate?
The chemical formula for disodium phosphate is HNa2PO4
