0
Respiration means breathing. You're probably doing it now;-)
Respiration also has another meaning, though the two functions are connected closely.
Breathing (respiration) is a physical exchange of gases (oxygen and carbon dioxide).
The formula, however, is:
glucose + oxygen = carbon dioxide + water + energy.
Hope i helped! :)
Wiki User
∙ 13y ago
Wiki User
∙ 12y agoC6 h12 O6 __equals_____ C02 + Glucose molecules and millibiltes
Wiki User
∙ 11y agoC6 H12 O6 + O2 → CO2 + H2O + About 30 ATP Energy
C6 H12 O6 is glucose, O2 is oxygen, H2O is water and ATP is an energy form, Adenine Triphosphate
Wiki User
∙ 14y agoC6 H12 O6 + 6 H20 + 6 CO2 + Energy
Add your answer:
Earn +20 pts
What do organisms need for aerobic cell respiration?
Oxygen and glucose. The formula for basic cellular respiration is: C6H12O6 (aq) + 6O2 (g) → 6CO2 (g) + 6H2O (l) ΔHc -2880 kJ (formula taken from wikipedia's article on cellular respiration)
Is carbon dioxide the only product of the Krebs cycle that is not reused or used in other stages of cellular respiration?
Yes, carbon dioxide is the only product of the Krebs cycle that is not reused or used in other stages of cellular respiration.
What is respiration using oxygen called?
Aerobic respiration is the respiration that requires oxygen. It needs oxygen in order to generate ATP. Anaerobic respiration does not require oxygen.
Is oxygen and energy released during cellular respiration?
No, oxygen is released in photosynthesis; Carbon dioxide is released in cellular respiration. Here is the formula for both C6H12O6(sugar)+ O2(oxygen)→ CO2(carbon dioxide)+ H2O + Energy - respiration CO2 + H2O + Energy(light) → C6H12O6 + O2 - photosynthesis As you can see they are opposites.
What are the types of respiration?
two types of respiration are aerobic respiration and anaerobic
How does the cellular reperation formula relate to the photosynthisis formula?
The products of the cellular respiration formula are the reactants of the photosynthesis formula, and the reactants of the cellular respiration formula are the products of the photosynthesis formula. Basically, they are opposite processes.
What is the process of taking in air into your body and giving it out is called?
Respiration or breathing. respiration is the more scientific term. The scientific formula for respiration is O2+C6H12O6(glucose)=CO2+H2O
What is the 36 ATP in the respiration formula?
energy
What do organisms need for aerobic cell respiration?
Oxygen and glucose. The formula for basic cellular respiration is: C6H12O6 (aq) + 6O2 (g) → 6CO2 (g) + 6H2O (l) ΔHc -2880 kJ (formula taken from wikipedia's article on cellular respiration)
Which life process creates energy from glucose?
Respiration. Glucose is basically sugar, which is taken in by organisms that use respiration by eating food. That respiration and oxygen taken in from the mouth or nose, is used. Look at the formula for respiration! Hope this helped!
What are the reactants in the cellular respiration formula?
Reactants are glucose and oxygen.Products are CO2 and water.
What are the starting materials in anaerobic respiration?
The formula for aerobic respiration: Oxygen + Glucose (+Energy) = Carbon Dioxide + Water The chemical formula: O2 + C6H12O6 (+Energy) = CO2 +H2O
How does reaction for photosynthesis compare to the cellular respiration?
they are they same. the products of photosynthesis are oxygen and glucose and the reactants of cellular respiration are gluose and oxygen.
How would Splenda affect respiration?
The chemical formula of Sucralose, which is found in Splenda and Equal, is C12H19Cl3O8. It has little to no effect on respiration as it is closely related to sugar and does not contain Aspartame.
Do photosynthesis and cellular respiration relate to each other?
Photosynthesis makes the energy(ATP), then the cellular respiration breaks it down to create food. The Formula is similar, but in opposite directions.
What are 3 products of oxidative respiration?
The three products of oxidation are carbon dioxide, water, and energy. Take the formula for sugar or fat and figure out the formula yourself.
What is the formula for oxidative respiration?
Glucose plus oxygen equals carbon dioxide and water plus energy
