Respiration means breathing. You're probably doing it now;-)
Respiration also has another meaning, though the two functions are connected closely.
Breathing (respiration) is a physical exchange of gases (oxygen and carbon dioxide).
The formula, however, is:
glucose + oxygen = carbon dioxide + water + energy.
Hope i helped! :)
C6 h12 O6 __equals_____ C02 + Glucose molecules and millibiltes
C6 H12 O6 + O2 → CO2 + H2O + About 30 ATP Energy
C6 H12 O6 is glucose, O2 is oxygen, H2O is water and ATP is an energy form, Adenine Triphosphate
C6 H12 O6 + 6 H20 + 6 CO2 + Energy
Oxygen and glucose. The formula for basic cellular respiration is: C6H12O6 (aq) + 6O2 (g) → 6CO2 (g) + 6H2O (l) ΔHc -2880 kJ (formula taken from wikipedia's article on cellular respiration)
Yes, carbon dioxide is the only product of the Krebs cycle that is not reused or used in other stages of cellular respiration.
Aerobic respiration is the respiration that requires oxygen. It needs oxygen in order to generate ATP. Anaerobic respiration does not require oxygen.
No, oxygen is released in photosynthesis; Carbon dioxide is released in cellular respiration. Here is the formula for both C6H12O6(sugar)+ O2(oxygen)→ CO2(carbon dioxide)+ H2O + Energy - respiration CO2 + H2O + Energy(light) → C6H12O6 + O2 - photosynthesis As you can see they are opposites.
two types of respiration are aerobic respiration and anaerobic
The products of the cellular respiration formula are the reactants of the photosynthesis formula, and the reactants of the cellular respiration formula are the products of the photosynthesis formula. Basically, they are opposite processes.
Respiration or breathing. respiration is the more scientific term. The scientific formula for respiration is O2+C6H12O6(glucose)=CO2+H2O
energy
Oxygen and glucose. The formula for basic cellular respiration is: C6H12O6 (aq) + 6O2 (g) → 6CO2 (g) + 6H2O (l) ΔHc -2880 kJ (formula taken from wikipedia's article on cellular respiration)
Respiration. Glucose is basically sugar, which is taken in by organisms that use respiration by eating food. That respiration and oxygen taken in from the mouth or nose, is used. Look at the formula for respiration! Hope this helped!
Reactants are glucose and oxygen.Products are CO2 and water.
The formula for aerobic respiration: Oxygen + Glucose (+Energy) = Carbon Dioxide + Water The chemical formula: O2 + C6H12O6 (+Energy) = CO2 +H2O
they are they same. the products of photosynthesis are oxygen and glucose and the reactants of cellular respiration are gluose and oxygen.
The chemical formula of Sucralose, which is found in Splenda and Equal, is C12H19Cl3O8. It has little to no effect on respiration as it is closely related to sugar and does not contain Aspartame.
Photosynthesis makes the energy(ATP), then the cellular respiration breaks it down to create food. The Formula is similar, but in opposite directions.
The three products of oxidation are carbon dioxide, water, and energy. Take the formula for sugar or fat and figure out the formula yourself.
Glucose plus oxygen equals carbon dioxide and water plus energy