0
What is the difference between sodium sulfite and sodium sulfate?
Wiki User
∙ 10y ago
No, these two chemicals are not the same. The difference is well-explained by the following excerpts from Wikipedia, accessed 2013 Feb 11:
"[A generic] chemical formula for sodium laureth sulfate is CH3(CH2)10CH2(OCH2CH2)nOSO3Na. Sometimes the number represented by n is specified in the name, for example laureth-2 sulfate. The product is heterogeneous in the number of ethoxyl groups, where n is the mean. ... The related surfactant sodium lauryl sulfate (also known as sodium dodecyl sulfate or SLS) is produced similarly, but without the ethoxylation step."
Wiki User
∙ 11y ago
Wiki User
∙ 13y agowhat is the difference sodium laureth sulphate and sodium ether sulphate
Wiki User
∙ 14y agoThe long carbon chain "tail". The laureth compound has 12 carbons in the tail, the myreth has 14.
Wiki User
∙ 10y agoSodium sulfite has the chemical formula Na2SO3. Sodium sulfate has the chemical formula Na2SO4.
Add your answer:
Earn +20 pts
How does sodium sulfite remove oxygen?
The sulfite ions, with formula SO3-2, are oxidized to sulfate ions, with formula SO4-2.
Sodium carbonate reacts with excess of sulfur dioxide?
sodium sulfite formed sodium sulfite formed
Why is sodium sulfite used to remove permanganate stains?
Sodium sulfite is used to remove permanganate stains because it is the only thing that can remove it. This is because the sodium sulfite breaks down the permanganate.
What is the correct name for a compound with the formula NH42SO4?
Ammonium sulfate is the chemical name for NH4 2SO3.
What is the empirical formula for sodium sulfite?
Na2SO3
What are the formula units for sodium sulfide sodium sulfite and sodium sulfate?
Sodium sulfide: Na2S Sodium sulfite: Na2SO3 Sodium sulfate: Na2SO4
What is the chemical name of Na2S2O4?
Sodium thiosulfate or Sodium Hyposulphite.
How does sodium sulfite remove oxygen?
The sulfite ions, with formula SO3-2, are oxidized to sulfate ions, with formula SO4-2.
What is the difference between sodium sulfide and sodium sulfate?
Sodium sulfate is Na2SO4. Sodium sulfide is Na2S.
Is sodium myreth sulfate like sodium chloride?
No, they are salts, but it is a big difference between these compounds.
Chemical formula for sodium hydrosulfite?
Hydrogen sulfite is the bisulfite anion, or HSO3-.Sulfite is SO32-.Do not confuse sulfite (SO32-) with sulfide (S2-), or sulfate (SO42-).
What names are in this compound Na2SO3?
Na2SO4 is the ionic compound sodium sulfate.
What is soda ash for swimming pools?
the production of such chemicals as sodium bicarbonate, sodium sulfate, sodium chromate, sodium phosphate, sodium silicate, potassium chloride, potassium sulfate, sodium sulfite
Is sodium sulfite an acid?
Sodium sulfite (NaSO3) is a salt of the sulfurous acid.
What is the reaction between sodium shalphate and water?
Sodium sulfate dissolves in water to produce a solution of sodium sulfate.
Sodium carbonate reacts with excess of sulfur dioxide?
sodium sulfite formed sodium sulfite formed
What is the IUPAC name for sodium sulfite?
Sodium sulphite is the IUPAC name. Its formula is Na2SO3 (NB there are only 3 oxygens in sulfite.
