0
What is the condensed structural formula for the alkane heptane which has a molecule formula of C7H16?
Wiki User
∙ 12y ago
What is the molecular shape of C7H16OH?
This as an alcohol made from an alkane ( all bonds single)
…...H...H…H….H….H….H..…H
H…C...C….C...C….C....C....C...O…H
…...H...H…H.…H….H….H..…H
Wiki User
∙ 14y ago
Wiki User
∙ 11y agoThe answer is tetrahedral because there are 4 electron groups around the central atom with 0 non-bonding electrons.
Wiki User
∙ 12y agoalkanes CnH2n+2
Wiki User
∙ 12y agoCh3-ch2-ch2-ch2-ch2-ch2-ch3
Wiki User
∙ 14y agoheptane
Wiki User
∙ 12y agoCnH2n
Add your answer:
Earn +20 pts
Structural formula of heptane?
The chemical equation for Heptane is C2H6.. Wrong Answer. Hepta means 7. Therefore, Heptane has 7 carbon atoms. Since alkanes have the general formula of CnH2n+2, if n is 7, 2n + 2 is 16. Therefore, Heptane has the formula of C7H16.
Is heptane a gas?
No, heptane is a liquid.
What is the PH of heptane?
Heptane has not a pH.
Is heptane attracted to a charged rod?
Heptane, C7H16, is an organic hydrocarbon that is nonpolar, thus it would not be attracted to a charged rod.
How many atoms are in heptane?
3
Structural formula of heptane?
The chemical equation for Heptane is C2H6.. Wrong Answer. Hepta means 7. Therefore, Heptane has 7 carbon atoms. Since alkanes have the general formula of CnH2n+2, if n is 7, 2n + 2 is 16. Therefore, Heptane has the formula of C7H16.
How many carbons are there in heptane?
Hept = seven. So 7 carbons are found in each molecule of heptane.
What is the chemical formula is heptane?
C7h16
What is heptanol?
A volatile, colorless, highly flammable liquid hydrocarbon, C7H16, obtained in the fractional distillation of petroleum and used as a standard in determining octane ratings, as an anesthetic, and as a solvent.
What is the btu value of heptane?
Heptane has the chemical formula of C7H16. It has a BTU rating of 19,163 BTU per pound and a rating of 4,465.8 kilojoules per mole.
What is the PH of heptane?
Heptane has not a pH.
Is heptane a gas?
No, heptane is a liquid.
How many molecules of water are produced when 3 molecules of heptane burn?
C7H16 + 1102 ------->8H2O + 7CO2 So 1 molecule of heptane produces 8 molecules of water on combustion and thus 3 molecules produces 24 molecules of water.
What compound could have a molecular formula of C7H16?
This formula corresponds to several saturated isomers of heptane as 2-methylhexane, 3-methylhexane, 2,3-dimethyl pentane e.t.c.
What type of organic molecule is petroleum ether?
It is a 'low boiling' volatile, highly flammable, liquid hydrocanbon mixture (e.g. pentane, hexane, and heptane).
Is heptane a solid at room temperature?
No, heptane is a liquid at room temperature.
What is the structure of 2-methyl-3-propylheptane?
Ethyl dimethyl heptane means essentially is a 7 C chain with a C2H5 group and two CH3 group (both attaching to the same carbon atom) attached to it. For more specific structure, a more detailed naming of the compound is needed. For instance, "2-ethyl-3,3-dimethyl-heptane" represents the structure CH3CH2(C2H5)CH(CH3)2C4H9. However, if one were to type the name "ethyl-dimethyl-heptane" in the software "ChemDraw" and convert it into a structure of the compound, the resulted conversion is in the form of "1-ethyl-1,1-dimethyl-heptane" or rather "3,3-dimethylnonane".
