0
What is the structural isomer of C8H18 with the lowest boiling point?
Wiki User
∙ 10y ago
In organic chemistry, alkanes such as C8H18 have structural isomers. The more these isomers are branched the lower the boiling point is. The reason for this, is that un-branched alkanes have a higher mass area, they are more likely to have more potential points of attachments for other atoms or molecules which would then raise intramolecular forces thus increasing boiling points. The structural isomer of C8H18 that has the boiling point is systematically known as 2,2,3,3-tetramethylbutane.
Wiki User
∙ 10y ago
Add your answer:
Earn +20 pts
What has the higher boiling point C2H6 or C3H8?
C20h42
What is the whole number coefficient of O2 when the equation for the combustion of C8H18 is completed and balanced?
The combustion reaction of octane is:2 C8H18 + 25 O2 = 16 CO2 + 18 H2OSo, the number of oxygen molecules is 25.The isomer trimethylpentane is used as standard in octane rating: the end of the scale at 100.
What is the condensed formula for 223trimethylpentane?
2,2,3- trimethyl pentane has the structural shape. CH3-C(CH3)2-CH(CH3)-CH2-CH3 C8H18 is the condensed /reduced formula.
How many moles of H are in 2 mol of c8h18?
2 moles C8H18 (18 moles H/1 mole C8H18) = 36 moles of hydrogen =================
What is the combustion of C8H18?
Combustion of Octane: 2 C8H18 + 17 O2 --> 16 CO2 + 9 H2O
Is calcium 8 and Hydrogen18 imicible in water?
If you meant C8H18, it is an octane-isomer, than the answer is NO, not miscible with water. Petrol contains a lot (>50%) of octane molecules.
What has the higher boiling point C2H6 or C3H8?
C20h42
What is C8h18 boiling point?
-1 degrees Celsius or about 30 degrees Fahrenheit.
What is the whole number coefficient of O2 when the equation for the combustion of C8H18 is completed and balanced?
The combustion reaction of octane is:2 C8H18 + 25 O2 = 16 CO2 + 18 H2OSo, the number of oxygen molecules is 25.The isomer trimethylpentane is used as standard in octane rating: the end of the scale at 100.
What is the condensed formula for 223trimethylpentane?
2,2,3- trimethyl pentane has the structural shape. CH3-C(CH3)2-CH(CH3)-CH2-CH3 C8H18 is the condensed /reduced formula.
Which is expected to have the largest dispersion forces CO2 C8H18 N2 C2H6?
C8h18
How many moles of H are in 2 mol of c8h18?
2 moles C8H18 (18 moles H/1 mole C8H18) = 36 moles of hydrogen =================
What is the reactant in the equation C8H18 plus O2CO2 plus H20?
The reactants are C8H18 and oxygen.
What is the equation for the formation of octane from its elements?
octane + oxygen -------> carbon dioxide + water
What is the combustion of C8H18?
Combustion of Octane: 2 C8H18 + 17 O2 --> 16 CO2 + 9 H2O
How do you balance C8H18 O2?
The chemical reaction is:2 C8H18 +25 O2 = 16 CO2 + 18 H2O
How do you balance C8H18 plus O2?
The chemical reaction is:2 C8H18 +25 O2 = 16 CO2 + 18 H2O
